C25H25F14NO5 — CID 87107683
bis(2,2,3,3,4,4,4-heptafluorobutanoic acid);(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol (PubChem CID 87107683) has the molecular formula C25H25F14NO5 and a molecular weight of 685.45 g/mol. Its IUPAC name is bis(2,2,3,3,4,4,4-heptafluorobutanoic acid);(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol.
| Compound Name | bis(2,2,3,3,4,4,4-heptafluorobutanoic acid);(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 87107683 |
| Molecular Formula | C25H25F14NO5 |
| Molecular Weight | 685.45 g/mol |
| Exact Mass | 685.15 |
| IUPAC Name | bis(2,2,3,3,4,4,4-heptafluorobutanoic acid);(1R,9R,10R)-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-ol |
| SMILES | CN1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(O)cc13.O=C(O)C(F)(F)C(F)(F)C(F)(F)F.O=C(O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H23NO.2C4HF7O2/c1-18-9-8-17-7-3-2-4-14(17)16(18)10-12-5-6-13(19)11-15(12)17;2*5-2(6,1(12)13)3(7,8)4(9,10)11/h5-6,11,14,16,19H,2-4,7-10H2,1H3;2*(H,12,13)/t14-,16+,17+;;/m0../s1 |
| InChIKey | UZTBJTGZGYYWDW-JBQXJEBLSA-N |
| XLogP | 6.89 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.45 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|