C18H23NO2 — CID 71285765
2-[(1R,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetic acid (PubChem CID 71285765) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 2-[(1R,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetic acid.
| Compound Name | 2-[(1R,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetic acid |
|---|---|
| PubChem CID | 71285765 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 2-[(1R,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc2c(c1)[C@@]13CCCC[C@@H]1[C@@H](C2)NCC3 |
| InChI | InChI=1S/C18H23NO2/c20-17(21)10-12-4-5-13-11-16-14-3-1-2-6-18(14,7-8-19-16)15(13)9-12/h4-5,9,14,16,19H,1-3,6-8,10-11H2,(H,20,21)/t14-,16-,18-/m1/s1 |
| InChIKey | VSPIKNGDYICQHY-QGPMSJSTSA-N |
| XLogP | 2.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |