C26H37NO7 — CID 67519244
[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 2,2-dimethylpropanoate;butanedioic acid (PubChem CID 67519244) has the molecular formula C26H37NO7 and a molecular weight of 475.58 g/mol. Its IUPAC name is [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 2,2-dimethylpropanoate;butanedioic acid.
| Compound Name | [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 2,2-dimethylpropanoate;butanedioic acid |
|---|---|
| PubChem CID | 67519244 |
| Molecular Formula | C26H37NO7 |
| Molecular Weight | 475.58 g/mol |
| Exact Mass | 475.26 |
| IUPAC Name | [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 2,2-dimethylpropanoate;butanedioic acid |
| SMILES | CC(C)(C)C(=O)OCOc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C22H31NO3.C4H6O4/c1-21(2,3)20(24)26-14-25-16-8-7-15-12-19-17-6-4-5-9-22(17,10-11-23-19)18(15)13-16;5-3(6)1-2-4(7)8/h7-8,13,17,19,23H,4-6,9-12,14H2,1-3H3;1-2H2,(H,5,6)(H,7,8)/t17-,19+,22+;/m0./s1 |
| InChIKey | UWIUCJVPGSJMLK-IOQGVJNZSA-N |
| XLogP | 3.89 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|