C26H37NO8 — CID 161065729
[(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 2,2-dimethylpropanoate;(2S)-2-hydroxybutanedioic acid (PubChem CID 161065729) has the molecular formula C26H37NO8 and a molecular weight of 491.58 g/mol. Its IUPAC name is [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 2,2-dimethylpropanoate;(2S)-2-hydroxybutanedioic acid.
| Compound Name | [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 2,2-dimethylpropanoate;(2S)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 161065729 |
| Molecular Formula | C26H37NO8 |
| Molecular Weight | 491.58 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 2,2-dimethylpropanoate;(2S)-2-hydroxybutanedioic acid |
| SMILES | CC(C)(C)C(=O)OCOc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)NCC3.O=C(O)C[C@H](O)C(=O)O |
| InChI | InChI=1S/C22H31NO3.C4H6O5/c1-21(2,3)20(24)26-14-25-16-8-7-15-12-19-17-6-4-5-9-22(17,10-11-23-19)18(15)13-16;5-2(4(8)9)1-3(6)7/h7-8,13,17,19,23H,4-6,9-12,14H2,1-3H3;2,5H,1H2,(H,6,7)(H,8,9)/t17-,19+,22+;2-/m10/s1 |
| InChIKey | UDZODRGVSIWWCR-GBGKINBUSA-N |
| XLogP | 2.86 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.58 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|