C27H33NO4 — CID 42608601
[(1R,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 1-phenylpropan-2-yl carbonate (PubChem CID 42608601) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is [(1R,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 1-phenylpropan-2-yl carbonate.
| Compound Name | [(1R,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 1-phenylpropan-2-yl carbonate |
|---|---|
| PubChem CID | 42608601 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | [(1R,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 1-phenylpropan-2-yl carbonate |
| SMILES | CC(Cc1ccccc1)OC(=O)OCOc1ccc2c(c1)[C@@]13CCCC[C@@H]1[C@H](C2)NCC3 |
| InChI | InChI=1S/C27H33NO4/c1-19(15-20-7-3-2-4-8-20)32-26(29)31-18-30-22-11-10-21-16-25-23-9-5-6-12-27(23,13-14-28-25)24(21)17-22/h2-4,7-8,10-11,17,19,23,25,28H,5-6,9,12-16,18H2,1H3/t19?,23-,25+,27-/m1/s1 |
| InChIKey | QMTJDUXJKPFNRH-XETMBDMTSA-N |
| XLogP | 5.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|