C41H56N2O5 — CID 67519493
bis[1-[[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-methylpropyl] carbonate (PubChem CID 67519493) has the molecular formula C41H56N2O5 and a molecular weight of 656.91 g/mol. Its IUPAC name is bis[1-[[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-methylpropyl] carbonate.
| Compound Name | bis[1-[[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-methylpropyl] carbonate |
|---|---|
| PubChem CID | 67519493 |
| Molecular Formula | C41H56N2O5 |
| Molecular Weight | 656.91 g/mol |
| Exact Mass | 656.42 |
| IUPAC Name | bis[1-[[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-2-methylpropyl] carbonate |
| SMILES | CC(C)C(OC(=O)OC(Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3)C(C)C)Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3 |
| InChI | InChI=1S/C41H56N2O5/c1-25(2)37(45-29-13-11-27-21-35-31-9-5-7-15-40(31,17-19-42-35)33(27)23-29)47-39(44)48-38(26(3)4)46-30-14-12-28-22-36-32-10-6-8-16-41(32,18-20-43-36)34(28)24-30/h11-14,23-26,31-32,35-38,42-43H,5-10,15-22H2,1-4H3/t31-,32-,35+,36+,37?,38?,40+,41+/m0/s1 |
| InChIKey | FJAYAWNXGKHQCC-WNCLPDJZSA-N |
| XLogP | 7.95 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.91 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|