C25H35NO4 — CID 67519173
[1-[[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-1-cyclohexylethyl] hydrogen carbonate (PubChem CID 67519173) has the molecular formula C25H35NO4 and a molecular weight of 413.56 g/mol. Its IUPAC name is [1-[[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-1-cyclohexylethyl] hydrogen carbonate.
| Compound Name | [1-[[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-1-cyclohexylethyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67519173 |
| Molecular Formula | C25H35NO4 |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.26 |
| IUPAC Name | [1-[[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy]-1-cyclohexylethyl] hydrogen carbonate |
| SMILES | CC(OC(=O)O)(Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3)C1CCCCC1 |
| InChI | InChI=1S/C25H35NO4/c1-24(30-23(27)28,18-7-3-2-4-8-18)29-19-11-10-17-15-22-20-9-5-6-12-25(20,13-14-26-22)21(17)16-19/h10-11,16,18,20,22,26H,2-9,12-15H2,1H3,(H,27,28)/t20-,22+,24?,25+/m0/s1 |
| InChIKey | GPDSUSLMZJGZOZ-ISPSJSMHSA-N |
| XLogP | 5.40 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|