C22H29NO4 — CID 67519217
[[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy-cyclobutylmethyl] hydrogen carbonate (PubChem CID 67519217) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is [[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy-cyclobutylmethyl] hydrogen carbonate.
| Compound Name | [[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy-cyclobutylmethyl] hydrogen carbonate |
|---|---|
| PubChem CID | 67519217 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | [[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxy-cyclobutylmethyl] hydrogen carbonate |
| SMILES | O=C(O)OC(Oc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3)C1CCC1 |
| InChI | InChI=1S/C22H29NO4/c24-21(25)27-20(14-4-3-5-14)26-16-8-7-15-12-19-17-6-1-2-9-22(17,10-11-23-19)18(15)13-16/h7-8,13-14,17,19-20,23H,1-6,9-12H2,(H,24,25)/t17-,19+,20?,22+/m0/s1 |
| InChIKey | UXCDHBIMWURNDJ-OGNXIXBOSA-N |
| XLogP | 4.23 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|