C17H20F3NO3S — CID 134490421
[(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate (PubChem CID 134490421) has the molecular formula C17H20F3NO3S and a molecular weight of 375.41 g/mol. Its IUPAC name is [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate.
| Compound Name | [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134490421 |
| Molecular Formula | C17H20F3NO3S |
| Molecular Weight | 375.41 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)NCC3)C(F)(F)F |
| InChI | InChI=1S/C17H20F3NO3S/c18-17(19,20)25(22,23)24-12-5-4-11-9-15-13-3-1-2-6-16(13,7-8-21-15)14(11)10-12/h4-5,10,13,15,21H,1-3,6-9H2/t13-,15+,16+/m1/s1 |
| InChIKey | IIKMMXUELCGKAI-KBMXLJTQSA-N |
| XLogP | 3.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|