C25H34F3NO5 — CID 42608626
[(1R,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 3,3-dimethylbutanoate;2,2,2-trifluoroacetic acid (PubChem CID 42608626) has the molecular formula C25H34F3NO5 and a molecular weight of 485.54 g/mol. Its IUPAC name is [(1R,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 3,3-dimethylbutanoate;2,2,2-trifluoroacetic acid.
| Compound Name | [(1R,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 3,3-dimethylbutanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 42608626 |
| Molecular Formula | C25H34F3NO5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.24 |
| IUPAC Name | [(1R,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl 3,3-dimethylbutanoate;2,2,2-trifluoroacetic acid |
| SMILES | CC(C)(C)CC(=O)OCOc1ccc2c(c1)[C@@]13CCCC[C@@H]1[C@H](C2)NCC3.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H33NO3.C2HF3O2/c1-22(2,3)14-21(25)27-15-26-17-8-7-16-12-20-18-6-4-5-9-23(18,10-11-24-20)19(16)13-17;3-2(4,5)1(6)7/h7-8,13,18,20,24H,4-6,9-12,14-15H2,1-3H3;(H,6,7)/t18-,20+,23-;/m1./s1 |
| InChIKey | CCWKSMQBDSSIRD-PRZQIIELSA-N |
| XLogP | 4.98 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|