C30H38F3NO4 — CID 158907093
[(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl adamantane-1-carboxylate;2,2,2-trifluoroacetaldehyde (PubChem CID 158907093) has the molecular formula C30H38F3NO4 and a molecular weight of 533.63 g/mol. Its IUPAC name is [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl adamantane-1-carboxylate;2,2,2-trifluoroacetaldehyde.
| Compound Name | [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl adamantane-1-carboxylate;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 158907093 |
| Molecular Formula | C30H38F3NO4 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl adamantane-1-carboxylate;2,2,2-trifluoroacetaldehyde |
| SMILES | O=C(OCOc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)NCC3)C12CC3CC(CC(C3)C1)C2.O=CC(F)(F)F |
| InChI | InChI=1S/C28H37NO3.C2HF3O/c30-26(27-14-18-9-19(15-27)11-20(10-18)16-27)32-17-31-22-5-4-21-12-25-23-3-1-2-6-28(23,7-8-29-25)24(21)13-22;3-2(4,5)1-6/h4-5,13,18-20,23,25,29H,1-3,6-12,14-17H2;1H/t18?,19?,20?,23-,25+,27?,28+;/m1./s1 |
| InChIKey | JGEGVLKQGDJBCI-UMJCBMPMSA-N |
| XLogP | 5.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|