C36H43NO5 — CID 59315842
benzyl (1S,9S,10S)-4-(adamantane-1-carbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 59315842) has the molecular formula C36H43NO5 and a molecular weight of 569.74 g/mol. Its IUPAC name is benzyl (1S,9S,10S)-4-(adamantane-1-carbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | benzyl (1S,9S,10S)-4-(adamantane-1-carbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 59315842 |
| Molecular Formula | C36H43NO5 |
| Molecular Weight | 569.74 g/mol |
| Exact Mass | 569.31 |
| IUPAC Name | benzyl (1S,9S,10S)-4-(adamantane-1-carbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@@]23CCCC[C@@H]2[C@@H]1Cc1ccc(OCOC(=O)C24CC5CC(CC(C5)C2)C4)cc13 |
| InChI | InChI=1S/C36H43NO5/c38-33(35-19-25-14-26(20-35)16-27(15-25)21-35)42-23-41-29-10-9-28-17-32-30-8-4-5-11-36(30,31(28)18-29)12-13-37(32)34(39)40-22-24-6-2-1-3-7-24/h1-3,6-7,9-10,18,25-27,30,32H,4-5,8,11-17,19-23H2/t25?,26?,27?,30-,32+,35?,36+/m1/s1 |
| InChIKey | YHEZHQPANGVJHD-NTDITZSQSA-N |
| XLogP | 7.18 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.74 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|