C29H35NO5 — CID 67519206
benzyl (1R,9R,10R)-4-(2-methylpropanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 67519206) has the molecular formula C29H35NO5 and a molecular weight of 477.60 g/mol. Its IUPAC name is benzyl (1R,9R,10R)-4-(2-methylpropanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | benzyl (1R,9R,10R)-4-(2-methylpropanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 67519206 |
| Molecular Formula | C29H35NO5 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.25 |
| IUPAC Name | benzyl (1R,9R,10R)-4-(2-methylpropanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | CC(C)C(=O)OCOc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(C(=O)OCc1ccccc1)CC3 |
| InChI | InChI=1S/C29H35NO5/c1-20(2)27(31)35-19-34-23-12-11-22-16-26-24-10-6-7-13-29(24,25(22)17-23)14-15-30(26)28(32)33-18-21-8-4-3-5-9-21/h3-5,8-9,11-12,17,20,24,26H,6-7,10,13-16,18-19H2,1-2H3/t24-,26+,29+/m0/s1 |
| InChIKey | HZUPZCJSXOQRHG-IHTKTJBKSA-N |
| XLogP | 5.62 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|