C30H37NO5 — CID 42608652
benzyl (1R,9S,10S)-4-(2-methylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 42608652) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is benzyl (1R,9S,10S)-4-(2-methylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | benzyl (1R,9S,10S)-4-(2-methylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 42608652 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | benzyl (1R,9S,10S)-4-(2-methylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | CCC(C)C(=O)OCOc1ccc2c(c1)[C@@]13CCCC[C@@H]1[C@H](C2)N(C(=O)OCc1ccccc1)CC3 |
| InChI | InChI=1S/C30H37NO5/c1-3-21(2)28(32)36-20-35-24-13-12-23-17-27-25-11-7-8-14-30(25,26(23)18-24)15-16-31(27)29(33)34-19-22-9-5-4-6-10-22/h4-6,9-10,12-13,18,21,25,27H,3,7-8,11,14-17,19-20H2,1-2H3/t21?,25-,27+,30-/m1/s1 |
| InChIKey | GLESCVOTWBAPAZ-VDMDEMIVSA-N |
| XLogP | 6.01 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|