C31H39NO6 — CID 25070712
benzyl (1S,9R,10S)-4-(pentan-2-yloxycarbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 25070712) has the molecular formula C31H39NO6 and a molecular weight of 521.65 g/mol. Its IUPAC name is benzyl (1S,9R,10S)-4-(pentan-2-yloxycarbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | benzyl (1S,9R,10S)-4-(pentan-2-yloxycarbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 25070712 |
| Molecular Formula | C31H39NO6 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | benzyl (1S,9R,10S)-4-(pentan-2-yloxycarbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | CCCC(C)OC(=O)OCOc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@@H](C2)N(C(=O)OCc1ccccc1)CC3 |
| InChI | InChI=1S/C31H39NO6/c1-3-9-22(2)38-30(34)37-21-36-25-14-13-24-18-28-26-12-7-8-15-31(26,27(24)19-25)16-17-32(28)29(33)35-20-23-10-5-4-6-11-23/h4-6,10-11,13-14,19,22,26,28H,3,7-9,12,15-18,20-21H2,1-2H3/t22?,26-,28-,31+/m1/s1 |
| InChIKey | KIQDCBREUPJZFU-GGZMOYIHSA-N |
| XLogP | 6.76 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|