C35H39NO5 — CID 67519176
benzyl (1R,9R,10R)-4-(2-phenylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 67519176) has the molecular formula C35H39NO5 and a molecular weight of 553.70 g/mol. Its IUPAC name is benzyl (1R,9R,10R)-4-(2-phenylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | benzyl (1R,9R,10R)-4-(2-phenylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 67519176 |
| Molecular Formula | C35H39NO5 |
| Molecular Weight | 553.70 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | benzyl (1R,9R,10R)-4-(2-phenylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | CCC(C(=O)OCOc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)N(C(=O)OCc1ccccc1)CC3)c1ccccc1 |
| InChI | InChI=1S/C35H39NO5/c1-2-29(26-13-7-4-8-14-26)33(37)41-24-40-28-17-16-27-21-32-30-15-9-10-18-35(30,31(27)22-28)19-20-36(32)34(38)39-23-25-11-5-3-6-12-25/h3-8,11-14,16-17,22,29-30,32H,2,9-10,15,18-21,23-24H2,1H3/t29?,30-,32+,35+/m0/s1 |
| InChIKey | INYIBUHXWVLFKA-OXHZPVSVSA-N |
| XLogP | 7.16 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.70 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|