C32H39NO6 — CID 25073840
benzyl (1S,9R,10S)-4-(cyclopentylmethoxycarbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 25073840) has the molecular formula C32H39NO6 and a molecular weight of 533.67 g/mol. Its IUPAC name is benzyl (1S,9R,10S)-4-(cyclopentylmethoxycarbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | benzyl (1S,9R,10S)-4-(cyclopentylmethoxycarbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 25073840 |
| Molecular Formula | C32H39NO6 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.28 |
| IUPAC Name | benzyl (1S,9R,10S)-4-(cyclopentylmethoxycarbonyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | O=C(OCOc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@@H](C2)N(C(=O)OCc1ccccc1)CC3)OCC1CCCC1 |
| InChI | InChI=1S/C32H39NO6/c34-30(36-20-23-8-2-1-3-9-23)33-17-16-32-15-7-6-12-27(32)29(33)18-25-13-14-26(19-28(25)32)38-22-39-31(35)37-21-24-10-4-5-11-24/h1-3,8-9,13-14,19,24,27,29H,4-7,10-12,15-18,20-22H2/t27-,29-,32+/m1/s1 |
| InChIKey | IUUFGLKIALPYHI-JLDIWXBFSA-N |
| XLogP | 6.76 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|