C31H30F3NO2 — CID 154308009
benzyl (1R,9R,10R)-4-[4-(trifluoromethyl)phenyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 154308009) has the molecular formula C31H30F3NO2 and a molecular weight of 505.58 g/mol. Its IUPAC name is benzyl (1R,9R,10R)-4-[4-(trifluoromethyl)phenyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | benzyl (1R,9R,10R)-4-[4-(trifluoromethyl)phenyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 154308009 |
| Molecular Formula | C31H30F3NO2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | benzyl (1R,9R,10R)-4-[4-(trifluoromethyl)phenyl]-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@]23CCCC[C@H]2[C@H]1Cc1ccc(-c2ccc(C(F)(F)F)cc2)cc13 |
| InChI | InChI=1S/C31H30F3NO2/c32-31(33,34)25-13-11-22(12-14-25)23-9-10-24-19-28-26-8-4-5-15-30(26,27(24)18-23)16-17-35(28)29(36)37-20-21-6-2-1-3-7-21/h1-3,6-7,9-14,18,26,28H,4-5,8,15-17,19-20H2/t26-,28+,30+/m0/s1 |
| InChIKey | QSROBDLRITZAQV-CVXIRMMQSA-N |
| XLogP | 7.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |