C25H28INO3 — CID 66960845
benzyl (1R,9R,10R)-5-iodo-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate (PubChem CID 66960845) has the molecular formula C25H28INO3 and a molecular weight of 517.41 g/mol. Its IUPAC name is benzyl (1R,9R,10R)-5-iodo-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate.
| Compound Name | benzyl (1R,9R,10R)-5-iodo-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate |
|---|---|
| PubChem CID | 66960845 |
| Molecular Formula | C25H28INO3 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | benzyl (1R,9R,10R)-5-iodo-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate |
| SMILES | COc1cc2c(cc1I)C[C@@H]1[C@@H]3CCCC[C@]23CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H28INO3/c1-29-23-15-20-18(13-21(23)26)14-22-19-9-5-6-10-25(19,20)11-12-27(22)24(28)30-16-17-7-3-2-4-8-17/h2-4,7-8,13,15,19,22H,5-6,9-12,14,16H2,1H3/t19-,22+,25+/m0/s1 |
| InChIKey | ALXJMNWUXBRURE-UWUFEASWSA-N |
| XLogP | 5.70 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|