C37H37N3O5 — CID 66959833
benzyl (1R,9R,10R)-5-(4-nitroanilino)-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate (PubChem CID 66959833) has the molecular formula C37H37N3O5 and a molecular weight of 603.72 g/mol. Its IUPAC name is benzyl (1R,9R,10R)-5-(4-nitroanilino)-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate.
| Compound Name | benzyl (1R,9R,10R)-5-(4-nitroanilino)-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate |
|---|---|
| PubChem CID | 66959833 |
| Molecular Formula | C37H37N3O5 |
| Molecular Weight | 603.72 g/mol |
| Exact Mass | 603.27 |
| IUPAC Name | benzyl (1R,9R,10R)-5-(4-nitroanilino)-4-phenylmethoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2,4,6-triene-17-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@]23CCCC[C@H]2[C@H]1Cc1cc(Nc2ccc([N+](=O)[O-])cc2)c(OCc2ccccc2)cc13 |
| InChI | InChI=1S/C37H37N3O5/c41-36(45-25-27-11-5-2-6-12-27)39-20-19-37-18-8-7-13-31(37)34(39)22-28-21-33(38-29-14-16-30(17-15-29)40(42)43)35(23-32(28)37)44-24-26-9-3-1-4-10-26/h1-6,9-12,14-17,21,23,31,34,38H,7-8,13,18-20,22,24-25H2/t31-,34+,37+/m0/s1 |
| InChIKey | PSDBZWJOJSUEHU-JTLVTJOGSA-N |
| XLogP | 8.31 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.72 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|