C36H42N2O4 — CID 88890686
benzyl (1S,9S)-4-butoxy-5-(2-formylanilino)-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2,4,6-triene-18-carboxylate (PubChem CID 88890686) has the molecular formula C36H42N2O4 and a molecular weight of 566.74 g/mol. Its IUPAC name is benzyl (1S,9S)-4-butoxy-5-(2-formylanilino)-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2,4,6-triene-18-carboxylate.
| Compound Name | benzyl (1S,9S)-4-butoxy-5-(2-formylanilino)-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2,4,6-triene-18-carboxylate |
|---|---|
| PubChem CID | 88890686 |
| Molecular Formula | C36H42N2O4 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | benzyl (1S,9S)-4-butoxy-5-(2-formylanilino)-18-azatetracyclo[7.5.4.01,10.02,7]octadeca-2,4,6-triene-18-carboxylate |
| SMILES | CCCCOc1cc2c(cc1Nc1ccccc1C=O)C[C@H]1C3CCCC[C@@]23CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H42N2O4/c1-2-3-20-41-34-23-30-28(21-32(34)37-31-16-8-7-14-27(31)24-39)22-33-29-15-9-10-17-36(29,30)18-11-19-38(33)35(40)42-25-26-12-5-4-6-13-26/h4-8,12-14,16,21,23-24,29,33,37H,2-3,9-11,15,17-20,22,25H2,1H3/t29?,33-,36-/m0/s1 |
| InChIKey | JOPMQYUARGFLAA-YNOCVOMASA-N |
| XLogP | 8.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|