C31H39NO5 — CID 42608634
benzyl (1R,9S,10S)-4-(2-ethylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate (PubChem CID 42608634) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is benzyl (1R,9S,10S)-4-(2-ethylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate.
| Compound Name | benzyl (1R,9S,10S)-4-(2-ethylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
|---|---|
| PubChem CID | 42608634 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | benzyl (1R,9S,10S)-4-(2-ethylbutanoyloxymethoxy)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene-17-carboxylate |
| SMILES | CCC(CC)C(=O)OCOc1ccc2c(c1)[C@@]13CCCC[C@@H]1[C@H](C2)N(C(=O)OCc1ccccc1)CC3 |
| InChI | InChI=1S/C31H39NO5/c1-3-23(4-2)29(33)37-21-36-25-14-13-24-18-28-26-12-8-9-15-31(26,27(24)19-25)16-17-32(28)30(34)35-20-22-10-6-5-7-11-22/h5-7,10-11,13-14,19,23,26,28H,3-4,8-9,12,15-18,20-21H2,1-2H3/t26-,28+,31-/m1/s1 |
| InChIKey | JWNTWBTURBXXPF-PNBNRWGDSA-N |
| XLogP | 6.40 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|