C23H30F3NO5 — CID 161007706
[(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate;2,2,2-trifluoroacetaldehyde (PubChem CID 161007706) has the molecular formula C23H30F3NO5 and a molecular weight of 457.49 g/mol. Its IUPAC name is [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate;2,2,2-trifluoroacetaldehyde.
| Compound Name | [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 161007706 |
| Molecular Formula | C23H30F3NO5 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [(1S,9S,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate;2,2,2-trifluoroacetaldehyde |
| SMILES | CC(C)OC(=O)OCOc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@H](C2)NCC3.O=CC(F)(F)F |
| InChI | InChI=1S/C21H29NO4.C2HF3O/c1-14(2)26-20(23)25-13-24-16-7-6-15-11-19-17-5-3-4-8-21(17,9-10-22-19)18(15)12-16;3-2(4,5)1-6/h6-7,12,14,17,19,22H,3-5,8-11,13H2,1-2H3;1H/t17-,19+,21+;/m1./s1 |
| InChIKey | TWSJWFAIWBRCEE-HFRKSQPXSA-N |
| XLogP | 4.68 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|