C28H35NO7 — CID 25074151
[(1S,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate;2-hydroxybenzoic acid (PubChem CID 25074151) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is [(1S,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate;2-hydroxybenzoic acid.
| Compound Name | [(1S,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate;2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 25074151 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | [(1S,9R,10S)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate;2-hydroxybenzoic acid |
| SMILES | CC(C)OC(=O)OCOc1ccc2c(c1)[C@]13CCCC[C@@H]1[C@@H](C2)NCC3.O=C(O)c1ccccc1O |
| InChI | InChI=1S/C21H29NO4.C7H6O3/c1-14(2)26-20(23)25-13-24-16-7-6-15-11-19-17-5-3-4-8-21(17,9-10-22-19)18(15)12-16;8-6-4-2-1-3-5(6)7(9)10/h6-7,12,14,17,19,22H,3-5,8-11,13H2,1-2H3;1-4,8H,(H,9,10)/t17-,19-,21+;/m1./s1 |
| InChIKey | KBSSYCFZIHTNJY-YNCXZEGQSA-N |
| XLogP | 5.02 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|