C25H31NO7S — CID 87508961
[(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl hydrogen carbonate;4-methylbenzenesulfonic acid (PubChem CID 87508961) has the molecular formula C25H31NO7S and a molecular weight of 489.59 g/mol. Its IUPAC name is [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl hydrogen carbonate;4-methylbenzenesulfonic acid.
| Compound Name | [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl hydrogen carbonate;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 87508961 |
| Molecular Formula | C25H31NO7S |
| Molecular Weight | 489.59 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | [(1R,9R,10R)-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl hydrogen carbonate;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=C(O)OCOc1ccc2c(c1)[C@@]13CCCC[C@H]1[C@@H](C2)NCC3 |
| InChI | InChI=1S/C18H23NO4.C7H8O3S/c20-17(21)23-11-22-13-5-4-12-9-16-14-3-1-2-6-18(14,7-8-19-16)15(12)10-13;1-6-2-4-7(5-3-6)11(8,9)10/h4-5,10,14,16,19H,1-3,6-9,11H2,(H,20,21);2-5H,1H3,(H,8,9,10)/t14-,16+,18+;/m0./s1 |
| InChIKey | LLSZXKIPISNKCM-QUQDROCISA-N |
| XLogP | 4.31 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|