C22H33NO4 — CID 144540190
[(1S,9R)-1-methyl-17-azatricyclo[7.5.3.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate (PubChem CID 144540190) has the molecular formula C22H33NO4 and a molecular weight of 375.51 g/mol. Its IUPAC name is [(1S,9R)-1-methyl-17-azatricyclo[7.5.3.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate.
| Compound Name | [(1S,9R)-1-methyl-17-azatricyclo[7.5.3.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate |
|---|---|
| PubChem CID | 144540190 |
| Molecular Formula | C22H33NO4 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.24 |
| IUPAC Name | [(1S,9R)-1-methyl-17-azatricyclo[7.5.3.02,7]heptadeca-2(7),3,5-trien-4-yl]oxymethyl propan-2-yl carbonate |
| SMILES | CC(C)OC(=O)OCOc1ccc2c(c1)[C@@]1(C)CCCCC[C@H](C2)NCC1 |
| InChI | InChI=1S/C22H33NO4/c1-16(2)27-21(24)26-15-25-19-9-8-17-13-18-7-5-4-6-10-22(3,11-12-23-18)20(17)14-19/h8-9,14,16,18,23H,4-7,10-13,15H2,1-3H3/t18-,22+/m1/s1 |
| InChIKey | KBIBDECHLKCCCU-GCJKJVERSA-N |
| XLogP | 4.71 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|