C21H33NO2 — CID 142351095
(1R,9S,16S)-1-methyl-4-(propan-2-yloxymethoxy)tricyclo[7.6.1.02,7]hexadeca-2(7),3,5-trien-16-amine (PubChem CID 142351095) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is (1R,9S,16S)-1-methyl-4-(propan-2-yloxymethoxy)tricyclo[7.6.1.02,7]hexadeca-2(7),3,5-trien-16-amine.
| Compound Name | (1R,9S,16S)-1-methyl-4-(propan-2-yloxymethoxy)tricyclo[7.6.1.02,7]hexadeca-2(7),3,5-trien-16-amine |
|---|---|
| PubChem CID | 142351095 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | (1R,9S,16S)-1-methyl-4-(propan-2-yloxymethoxy)tricyclo[7.6.1.02,7]hexadeca-2(7),3,5-trien-16-amine |
| SMILES | CC(C)OCOc1ccc2c(c1)[C@@]1(C)CCCCCC[C@@H](C2)[C@@H]1N |
| InChI | InChI=1S/C21H33NO2/c1-15(2)23-14-24-18-10-9-16-12-17-8-6-4-5-7-11-21(3,20(17)22)19(16)13-18/h9-10,13,15,17,20H,4-8,11-12,14,22H2,1-3H3/t17-,20-,21+/m0/s1 |
| InChIKey | SVGQREAGDLFGTH-DZFGPLHGSA-N |
| XLogP | 4.56 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|