C22H34N2O4 — CID 138671887
[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-[2-(2-methoxyethoxy)ethyl]carbamate (PubChem CID 138671887) has the molecular formula C22H34N2O4 and a molecular weight of 390.52 g/mol. Its IUPAC name is [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-[2-(2-methoxyethoxy)ethyl]carbamate.
| Compound Name | [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-[2-(2-methoxyethoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 138671887 |
| Molecular Formula | C22H34N2O4 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.25 |
| IUPAC Name | [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-[2-(2-methoxyethoxy)ethyl]carbamate |
| SMILES | COCCOCCNC(=O)Oc1ccc2c(c1)[C@@]1(C)CCCCC[C@@H](C2)[C@@H]1N |
| InChI | InChI=1S/C22H34N2O4/c1-22-9-5-3-4-6-17(20(22)23)14-16-7-8-18(15-19(16)22)28-21(25)24-10-11-27-13-12-26-2/h7-8,15,17,20H,3-6,9-14,23H2,1-2H3,(H,24,25)/t17-,20-,22+/m0/s1 |
| InChIKey | FAZDCCFKVKEJGO-RBDMOPTHSA-N |
| XLogP | 3.16 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|