C40H52F2N2O4 — CID 139492252
bis[(1R,9S,15S)-15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] cyclohexane-1,4-dicarboxylate (PubChem CID 139492252) has the molecular formula C40H52F2N2O4 and a molecular weight of 662.86 g/mol. Its IUPAC name is bis[(1R,9S,15S)-15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[(1R,9S,15S)-15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139492252 |
| Molecular Formula | C40H52F2N2O4 |
| Molecular Weight | 662.86 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | bis[(1R,9S,15S)-15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] cyclohexane-1,4-dicarboxylate |
| SMILES | C[C@@]12CCCCC[C@@H](Cc3c(F)cc(OC(=O)C4CCC(C(=O)Oc5cc(F)c6c(c5)[C@@]5(C)CCCCC[C@@H](C6)[C@@H]5N)CC4)cc31)[C@@H]2N |
| InChI | InChI=1S/C40H52F2N2O4/c1-39-15-7-3-5-9-25(35(39)43)17-29-31(39)19-27(21-33(29)41)47-37(45)23-11-13-24(14-12-23)38(46)48-28-20-32-30(34(42)22-28)18-26-10-6-4-8-16-40(32,2)36(26)44/h19-26,35-36H,3-18,43-44H2,1-2H3/t23?,24?,25-,26-,35-,36-,39+,40+/m0/s1 |
| InChIKey | KQCRYBZGQOLPHD-MRKVOEPLSA-N |
| XLogP | 7.72 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.86 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|