C24H36FNO2 — CID 155151036
(15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl) octanoate (PubChem CID 155151036) has the molecular formula C24H36FNO2 and a molecular weight of 389.56 g/mol. Its IUPAC name is (15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl) octanoate.
| Compound Name | (15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl) octanoate |
|---|---|
| PubChem CID | 155151036 |
| Molecular Formula | C24H36FNO2 |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.27 |
| IUPAC Name | (15-amino-6-fluoro-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl) octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc(F)c2c(c1)C1(C)CCCCCC(C2)C1N |
| InChI | InChI=1S/C24H36FNO2/c1-3-4-5-6-9-12-22(27)28-18-15-20-19(21(25)16-18)14-17-11-8-7-10-13-24(20,2)23(17)26/h15-17,23H,3-14,26H2,1-2H3 |
| InChIKey | WHJFWQPNDMXKHA-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|