C22H31NO3 — CID 157393240
[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 3-(oxetan-3-yl)propanoate (PubChem CID 157393240) has the molecular formula C22H31NO3 and a molecular weight of 357.49 g/mol. Its IUPAC name is [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 3-(oxetan-3-yl)propanoate.
| Compound Name | [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 3-(oxetan-3-yl)propanoate |
|---|---|
| PubChem CID | 157393240 |
| Molecular Formula | C22H31NO3 |
| Molecular Weight | 357.49 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 3-(oxetan-3-yl)propanoate |
| SMILES | C[C@@]12CCCCC[C@@H](Cc3ccc(OC(=O)CCC4COC4)cc31)[C@@H]2N |
| InChI | InChI=1S/C22H31NO3/c1-22-10-4-2-3-5-17(21(22)23)11-16-7-8-18(12-19(16)22)26-20(24)9-6-15-13-25-14-15/h7-8,12,15,17,21H,2-6,9-11,13-14,23H2,1H3/t17-,21-,22+/m0/s1 |
| InChIKey | PWEXTGPZCGVKBP-BULFRSBZSA-N |
| XLogP | 3.74 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.49 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|