C25H29NO4 — CID 138672954
2-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 1-O-methyl benzene-1,2-dicarboxylate (PubChem CID 138672954) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 1-O-methyl benzene-1,2-dicarboxylate.
| Compound Name | 2-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 1-O-methyl benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 138672954 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | 2-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] 1-O-methyl benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccccc1C(=O)Oc1ccc2c(c1)[C@@]1(C)CCCCC[C@@H](C2)[C@@H]1N |
| InChI | InChI=1S/C25H29NO4/c1-25-13-7-3-4-8-17(22(25)26)14-16-11-12-18(15-21(16)25)30-24(28)20-10-6-5-9-19(20)23(27)29-2/h5-6,9-12,15,17,22H,3-4,7-8,13-14,26H2,1-2H3/t17-,22-,25+/m0/s1 |
| InChIKey | YEOYJKBRTKZNRN-QOKIKDITSA-N |
| XLogP | 4.41 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|