C23H34N2O7 — CID 138672956
[(1R,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]carbamate (PubChem CID 138672956) has the molecular formula C23H34N2O7 and a molecular weight of 450.53 g/mol. Its IUPAC name is [(1R,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]carbamate.
| Compound Name | [(1R,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 138672956 |
| Molecular Formula | C23H34N2O7 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | [(1R,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-[[(2R,3R,4S,5R,6S)-3,4,5,6-tetrahydroxyoxan-2-yl]methyl]carbamate |
| SMILES | C[C@@]12CCCCCC(Cc3ccc(OC(=O)NC[C@H]4O[C@H](O)[C@H](O)[C@@H](O)[C@H]4O)cc31)[C@@H]2N |
| InChI | InChI=1S/C23H34N2O7/c1-23-8-4-2-3-5-13(20(23)24)9-12-6-7-14(10-15(12)23)31-22(30)25-11-16-17(26)18(27)19(28)21(29)32-16/h6-7,10,13,16-21,26-29H,2-5,8-9,11,24H2,1H3,(H,25,30)/t13?,16-,17+,18+,19-,20+,21+,23-/m1/s1 |
| InChIKey | LVKSZPMRGIZDLU-JPQNKNAXSA-N |
| XLogP | 0.30 |
| TPSA | 154.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |