C29H39NO2 — CID 138671915
[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] (2S)-2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 138671915) has the molecular formula C29H39NO2 and a molecular weight of 433.64 g/mol. Its IUPAC name is [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] (2S)-2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 138671915 |
| Molecular Formula | C29H39NO2 |
| Molecular Weight | 433.64 g/mol |
| Exact Mass | 433.30 |
| IUPAC Name | [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc([C@H](C)C(=O)Oc2ccc3c(c2)[C@@]2(C)CCCCC[C@@H](C3)[C@@H]2N)cc1 |
| InChI | InChI=1S/C29H39NO2/c1-19(2)16-21-9-11-22(12-10-21)20(3)28(31)32-25-14-13-23-17-24-8-6-5-7-15-29(4,27(24)30)26(23)18-25/h9-14,18-20,24,27H,5-8,15-17,30H2,1-4H3/t20-,24-,27-,29+/m0/s1 |
| InChIKey | GNZFJADTQKYUMJ-BZALYENOSA-N |
| XLogP | 6.32 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.64 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|