C23H29NO — CID 155036156
(1R,9S,15S)-1-methyl-4-phenylmethoxytricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine (PubChem CID 155036156) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is (1R,9S,15S)-1-methyl-4-phenylmethoxytricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine.
| Compound Name | (1R,9S,15S)-1-methyl-4-phenylmethoxytricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine |
|---|---|
| PubChem CID | 155036156 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (1R,9S,15S)-1-methyl-4-phenylmethoxytricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trien-15-amine |
| SMILES | C[C@@]12CCCCC[C@@H](Cc3ccc(OCc4ccccc4)cc31)[C@@H]2N |
| InChI | InChI=1S/C23H29NO/c1-23-13-7-3-6-10-19(22(23)24)14-18-11-12-20(15-21(18)23)25-16-17-8-4-2-5-9-17/h2,4-5,8-9,11-12,15,19,22H,3,6-7,10,13-14,16,24H2,1H3/t19-,22-,23+/m0/s1 |
| InChIKey | XKEUXZJGJIXYDX-AJSBUHFISA-N |
| XLogP | 4.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |