C26H34N2O2 — CID 138672261
[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-(4-propan-2-ylphenyl)carbamate (PubChem CID 138672261) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-(4-propan-2-ylphenyl)carbamate.
| Compound Name | [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-(4-propan-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 138672261 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | [(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] N-(4-propan-2-ylphenyl)carbamate |
| SMILES | CC(C)c1ccc(NC(=O)Oc2ccc3c(c2)[C@@]2(C)CCCCC[C@@H](C3)[C@@H]2N)cc1 |
| InChI | InChI=1S/C26H34N2O2/c1-17(2)18-8-11-21(12-9-18)28-25(29)30-22-13-10-19-15-20-7-5-4-6-14-26(3,24(20)27)23(19)16-22/h8-13,16-17,20,24H,4-7,14-15,27H2,1-3H3,(H,28,29)/t20-,24-,26+/m0/s1 |
| InChIKey | HTNTVIIJOBFXFV-OCDQVXHZSA-N |
| XLogP | 6.14 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |