C38H50N2O4 — CID 139492360
6-O-[(1R,9Z,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5,9-tetraenyl] 1-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] hexanedioate (PubChem CID 139492360) has the molecular formula C38H50N2O4 and a molecular weight of 598.83 g/mol. Its IUPAC name is 6-O-[(1R,9Z,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5,9-tetraenyl] 1-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] hexanedioate.
| Compound Name | 6-O-[(1R,9Z,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5,9-tetraenyl] 1-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] hexanedioate |
|---|---|
| PubChem CID | 139492360 |
| Molecular Formula | C38H50N2O4 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.38 |
| IUPAC Name | 6-O-[(1R,9Z,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5,9-tetraenyl] 1-O-[(1R,9S,15S)-15-amino-1-methyl-4-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl] hexanedioate |
| SMILES | C[C@@]12CCCC/C=C(/Cc3ccc(OC(=O)CCCCC(=O)Oc4ccc5c(c4)[C@@]4(C)CCCCC[C@@H](C5)[C@@H]4N)cc31)C2N |
| InChI | InChI=1S/C38H50N2O4/c1-37-19-9-3-5-11-27(35(37)39)21-25-15-17-29(23-31(25)37)43-33(41)13-7-8-14-34(42)44-30-18-16-26-22-28-12-6-4-10-20-38(2,36(28)40)32(26)24-30/h11,15-18,23-24,28,35-36H,3-10,12-14,19-22,39-40H2,1-2H3/b27-11-/t28-,35?,36-,37+,38+/m0/s1 |
| InChIKey | YWOJWASWPHMXNM-QZPXBACLSA-N |
| XLogP | 7.12 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|