C17H24FNO2 — CID 139492342
N-[(1R)-6-fluoro-4-methoxy-1-methyl-15-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl]hydroxylamine (PubChem CID 139492342) has the molecular formula C17H24FNO2 and a molecular weight of 293.38 g/mol. Its IUPAC name is N-[(1R)-6-fluoro-4-methoxy-1-methyl-15-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl]hydroxylamine.
| Compound Name | N-[(1R)-6-fluoro-4-methoxy-1-methyl-15-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl]hydroxylamine |
|---|---|
| PubChem CID | 139492342 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | N-[(1R)-6-fluoro-4-methoxy-1-methyl-15-tricyclo[7.5.1.02,7]pentadeca-2(7),3,5-trienyl]hydroxylamine |
| SMILES | COc1cc(F)c2c(c1)[C@@]1(C)CCCCCC(C2)C1NO |
| InChI | InChI=1S/C17H24FNO2/c1-17-7-5-3-4-6-11(16(17)19-20)8-13-14(17)9-12(21-2)10-15(13)18/h9-11,16,19-20H,3-8H2,1-2H3/t11?,16?,17-/m1/s1 |
| InChIKey | WPIWIDVOCUCXNE-ATVIMWCOSA-N |
| XLogP | 3.58 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|