C12H13FO2 — CID 146360843
4-fluoro-6-methoxy-7b-methyl-2,3-dihydro-1aH-naphtho[1,2-b]oxirene (PubChem CID 146360843) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 4-fluoro-6-methoxy-7b-methyl-2,3-dihydro-1aH-naphtho[1,2-b]oxirene.
| Compound Name | 4-fluoro-6-methoxy-7b-methyl-2,3-dihydro-1aH-naphtho[1,2-b]oxirene |
|---|---|
| PubChem CID | 146360843 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-fluoro-6-methoxy-7b-methyl-2,3-dihydro-1aH-naphtho[1,2-b]oxirene |
| SMILES | COc1cc(F)c2c(c1)C1(C)OC1CC2 |
| InChI | InChI=1S/C12H13FO2/c1-12-9-5-7(14-2)6-10(13)8(9)3-4-11(12)15-12/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | GNXINWBOJIXZQS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|