C12H14O2 — CID 54098142
6-methoxy-7b-methyl-2,3-dihydro-1aH-naphtho[1,2-b]oxirene (PubChem CID 54098142) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 6-methoxy-7b-methyl-2,3-dihydro-1aH-naphtho[1,2-b]oxirene.
| Compound Name | 6-methoxy-7b-methyl-2,3-dihydro-1aH-naphtho[1,2-b]oxirene |
|---|---|
| PubChem CID | 54098142 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 6-methoxy-7b-methyl-2,3-dihydro-1aH-naphtho[1,2-b]oxirene |
| SMILES | COc1ccc2c(c1)C1(C)OC1CC2 |
| InChI | InChI=1S/C12H14O2/c1-12-10-7-9(13-2)5-3-8(10)4-6-11(12)14-12/h3,5,7,11H,4,6H2,1-2H3 |
| InChIKey | MYPKVMVMWBBFLP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|