C18H24O3 — CID 158179701
(1R,4aS,10aS)-6-methoxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene;carbon dioxide (PubChem CID 158179701) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (1R,4aS,10aS)-6-methoxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene;carbon dioxide.
| Compound Name | (1R,4aS,10aS)-6-methoxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene;carbon dioxide |
|---|---|
| PubChem CID | 158179701 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (1R,4aS,10aS)-6-methoxy-1,4a-dimethyl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene;carbon dioxide |
| SMILES | COc1ccc2c(c1)[C@@]1(C)CCC[C@@H](C)[C@@H]1CC2.O=C=O |
| InChI | InChI=1S/C17H24O.CO2/c1-12-5-4-10-17(2)15(12)9-7-13-6-8-14(18-3)11-16(13)17;2-1-3/h6,8,11-12,15H,4-5,7,9-10H2,1-3H3;/t12-,15+,17+;/m1./s1 |
| InChIKey | FYKXHVGKSFTDNX-VSTSFNLTSA-N |
| XLogP | 3.75 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |