C18H25IO — CID 66806738
(2S,4aS)-2-iodo-6-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene (PubChem CID 66806738) has the molecular formula C18H25IO and a molecular weight of 384.30 g/mol. Its IUPAC name is (2S,4aS)-2-iodo-6-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene.
| Compound Name | (2S,4aS)-2-iodo-6-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene |
|---|---|
| PubChem CID | 66806738 |
| Molecular Formula | C18H25IO |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | (2S,4aS)-2-iodo-6-methoxy-1,1,4a-trimethyl-2,3,4,9,10,10a-hexahydrophenanthrene |
| SMILES | COc1ccc2c(c1)[C@@]1(C)CC[C@H](I)C(C)(C)C1CC2 |
| InChI | InChI=1S/C18H25IO/c1-17(2)15-8-6-12-5-7-13(20-4)11-14(12)18(15,3)10-9-16(17)19/h5,7,11,15-16H,6,8-10H2,1-4H3/t15?,16-,18+/m0/s1 |
| InChIKey | KSKPZVRAXUWEMF-BSRYDQRCSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|