C20H24N2O — CID 155510816
(12aS)-2-methoxy-7,7,12a-trimethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinoxaline (PubChem CID 155510816) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is (12aS)-2-methoxy-7,7,12a-trimethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinoxaline.
| Compound Name | (12aS)-2-methoxy-7,7,12a-trimethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinoxaline |
|---|---|
| PubChem CID | 155510816 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (12aS)-2-methoxy-7,7,12a-trimethyl-5,6,6a,12-tetrahydronaphtho[1,2-g]quinoxaline |
| SMILES | COc1ccc2c(c1)[C@@]1(C)Cc3nccnc3C(C)(C)C1CC2 |
| InChI | InChI=1S/C20H24N2O/c1-19(2)17-8-6-13-5-7-14(23-4)11-15(13)20(17,3)12-16-18(19)22-10-9-21-16/h5,7,9-11,17H,6,8,12H2,1-4H3/t17?,20-/m1/s1 |
| InChIKey | IGLYHABNNXGDGB-UUSAFJCLSA-N |
| XLogP | 3.84 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |