C17H22O2 — CID 58886884
(1S,10aS)-6-methoxy-1,4a-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one (PubChem CID 58886884) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is (1S,10aS)-6-methoxy-1,4a-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one.
| Compound Name | (1S,10aS)-6-methoxy-1,4a-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one |
|---|---|
| PubChem CID | 58886884 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | (1S,10aS)-6-methoxy-1,4a-dimethyl-1,3,4,9,10,10a-hexahydrophenanthren-2-one |
| SMILES | COc1ccc2c(c1)C1(C)CCC(=O)[C@@H](C)[C@@H]1CC2 |
| InChI | InChI=1S/C17H22O2/c1-11-14-7-5-12-4-6-13(19-3)10-15(12)17(14,2)9-8-16(11)18/h4,6,10-11,14H,5,7-9H2,1-3H3/t11-,14-,17?/m0/s1 |
| InChIKey | ARQWDRJQNVGDTI-UKOIWPHMSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |