C13H15ClO4 — CID 143390413
2-(2-chloro-1-hydroxy-7-methoxy-3,4-dihydro-2H-naphthalen-1-yl)acetic acid (PubChem CID 143390413) has the molecular formula C13H15ClO4 and a molecular weight of 270.71 g/mol. Its IUPAC name is 2-(2-chloro-1-hydroxy-7-methoxy-3,4-dihydro-2H-naphthalen-1-yl)acetic acid.
| Compound Name | 2-(2-chloro-1-hydroxy-7-methoxy-3,4-dihydro-2H-naphthalen-1-yl)acetic acid |
|---|---|
| PubChem CID | 143390413 |
| Molecular Formula | C13H15ClO4 |
| Molecular Weight | 270.71 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(2-chloro-1-hydroxy-7-methoxy-3,4-dihydro-2H-naphthalen-1-yl)acetic acid |
| SMILES | COc1ccc2c(c1)C(O)(CC(=O)O)C(Cl)CC2 |
| InChI | InChI=1S/C13H15ClO4/c1-18-9-4-2-8-3-5-11(14)13(17,7-12(15)16)10(8)6-9/h2,4,6,11,17H,3,5,7H2,1H3,(H,15,16) |
| InChIKey | JBRCFOUXPXWTMM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.71 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|