2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid

C14H18O3 — CID 11172367

IUPAC2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid
SMILESCOc1ccc2c(c1)C(C)(C)C(CC(=O)O)C2
InChIInChI=1S/C14H18O3/c1-14(2)10(7-13(15)16)6-9-4-5-11(17-3)8-12(9)14/h4-5,8,10H,6-7H2,1-3H3,(H,15,16)
InChIKeyJWXWMVVDPIIMNC-UHFFFAOYSA-N
MW234.29 g/mol
LogP2.62
Rot. Bonds3

About 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid

2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid (PubChem CID 11172367) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid.

Molecular Properties

Compound Name2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid
PubChem CID11172367
Molecular FormulaC14H18O3
Molecular Weight234.29 g/mol
Exact Mass234.13
IUPAC Name2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid
SMILESCOc1ccc2c(c1)C(C)(C)C(CC(=O)O)C2
InChIInChI=1S/C14H18O3/c1-14(2)10(7-13(15)16)6-9-4-5-11(17-3)8-12(9)14/h4-5,8,10H,6-7H2,1-3H3,(H,15,16)
InChIKeyJWXWMVVDPIIMNC-UHFFFAOYSA-N
XLogP2.62
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.29
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid?
The IUPAC name of 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid (CID 11172367) is 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid.
What is the SMILES notation for 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid?
The canonical SMILES for 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid is COc1ccc2c(c1)C(C)(C)C(CC(=O)O)C2.
What is the InChIKey of 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid?
The InChIKey is JWXWMVVDPIIMNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-14(2)10(7-13(15)16)6-9-4-5-11(17-3)8-12(9)14/h4-5,8,10H,6-7H2,1-3H3,(H,15,16).
What are the key properties of 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid?
2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid has a molecular weight of 234.29 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid is sourced from PubChem (CID 11172367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).