C14H18O3 — CID 11172367
2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid (PubChem CID 11172367) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid.
| Compound Name | 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid |
|---|---|
| PubChem CID | 11172367 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 2-(5-methoxy-3,3-dimethyl-1,2-dihydroinden-2-yl)acetic acid |
| SMILES | COc1ccc2c(c1)C(C)(C)C(CC(=O)O)C2 |
| InChI | InChI=1S/C14H18O3/c1-14(2)10(7-13(15)16)6-9-4-5-11(17-3)8-12(9)14/h4-5,8,10H,6-7H2,1-3H3,(H,15,16) |
| InChIKey | JWXWMVVDPIIMNC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |