C18H25NO2 — CID 86733859
1-[(4aR,10aS)-7-methoxy-5,5-dimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-1-yl]ethanone (PubChem CID 86733859) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-[(4aR,10aS)-7-methoxy-5,5-dimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-1-yl]ethanone.
| Compound Name | 1-[(4aR,10aS)-7-methoxy-5,5-dimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-1-yl]ethanone |
|---|---|
| PubChem CID | 86733859 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-[(4aR,10aS)-7-methoxy-5,5-dimethyl-2,3,4,4a,10,10a-hexahydrobenzo[g]quinolin-1-yl]ethanone |
| SMILES | COc1ccc2c(c1)C(C)(C)[C@H]1CCCN(C(C)=O)[C@H]1C2 |
| InChI | InChI=1S/C18H25NO2/c1-12(20)19-9-5-6-15-17(19)10-13-7-8-14(21-4)11-16(13)18(15,2)3/h7-8,11,15,17H,5-6,9-10H2,1-4H3/t15-,17-/m0/s1 |
| InChIKey | OYVKTEHSTVYOFA-RDJZCZTQSA-N |
| XLogP | 3.16 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |