C18H26NO4P — CID 58600413
methoxy-[(1R,9R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]phosphinic acid (PubChem CID 58600413) has the molecular formula C18H26NO4P and a molecular weight of 351.38 g/mol. Its IUPAC name is methoxy-[(1R,9R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]phosphinic acid.
| Compound Name | methoxy-[(1R,9R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]phosphinic acid |
|---|---|
| PubChem CID | 58600413 |
| Molecular Formula | C18H26NO4P |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | methoxy-[(1R,9R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]phosphinic acid |
| SMILES | COc1ccc2c(c1)[C@@]13CCCCC1[C@@H](C2)N(P(=O)(O)OC)CC3 |
| InChI | InChI=1S/C18H26NO4P/c1-22-14-7-6-13-11-17-15-5-3-4-8-18(15,16(13)12-14)9-10-19(17)24(20,21)23-2/h6-7,12,15,17H,3-5,8-11H2,1-2H3,(H,20,21)/t15?,17-,18-/m1/s1 |
| InChIKey | WZBJUDPTXPWRSR-HSFDIDPMSA-N |
| XLogP | 3.50 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|