C19H28NO4P — CID 58600404
(1R,9R)-17-dimethoxyphosphoryl-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (PubChem CID 58600404) has the molecular formula C19H28NO4P and a molecular weight of 365.41 g/mol. Its IUPAC name is (1R,9R)-17-dimethoxyphosphoryl-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene.
| Compound Name | (1R,9R)-17-dimethoxyphosphoryl-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 58600404 |
| Molecular Formula | C19H28NO4P |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (1R,9R)-17-dimethoxyphosphoryl-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@@]13CCCCC1[C@@H](C2)N(P(=O)(OC)OC)CC3 |
| InChI | InChI=1S/C19H28NO4P/c1-22-15-8-7-14-12-18-16-6-4-5-9-19(16,17(14)13-15)10-11-20(18)25(21,23-2)24-3/h7-8,13,16,18H,4-6,9-12H2,1-3H3/t16?,18-,19-/m1/s1 |
| InChIKey | KRIYIYJRYMGOSM-VOBHOPKGSA-N |
| XLogP | 4.15 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|