C21H27NO2 — CID 21457321
(E)-1-[(1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]but-2-en-1-one (PubChem CID 21457321) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is (E)-1-[(1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]but-2-en-1-one.
| Compound Name | (E)-1-[(1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 21457321 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | (E)-1-[(1R,9S,10R)-4-methoxy-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-17-yl]but-2-en-1-one |
| SMILES | C/C=C/C(=O)N1CC[C@]23CCCC[C@H]2[C@@H]1Cc1ccc(OC)cc13 |
| InChI | InChI=1S/C21H27NO2/c1-3-6-20(23)22-12-11-21-10-5-4-7-17(21)19(22)13-15-8-9-16(24-2)14-18(15)21/h3,6,8-9,14,17,19H,4-5,7,10-13H2,1-2H3/b6-3+/t17-,19-,21+/m0/s1 |
| InChIKey | LWRNDLAAOJBRCD-RSLOTZEPSA-N |
| XLogP | 3.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|